| Identification | Back Directory | [Name]
4-CHLORO-2,6-DINITROANILINE | [CAS]
5388-62-5 | [Synonyms]
TIMTEC-BB SBB003374 4-CHLORO-2,6-DINITROANILINE 2,6-dinitro-4-chloro-anilin 4-chloro-2,6-dinitro-anilin 2,6-DINITRO-4-CHLOROANILINE 4-chloro-2,6-dinitro-benzenamin 4-chloro-2,6-dinitro-Benzenamine benzenamine,-chloro-2,6-dinitro- Benzenamine, 4-chloro-2,6-dinitro- | [EINECS(EC#)]
226-381-5 | [Molecular Formula]
C6H4ClN3O4 | [MDL Number]
MFCD00075113 | [MOL File]
5388-62-5.mol | [Molecular Weight]
217.57 |
| Chemical Properties | Back Directory | [Melting point ]
145-147 °C (lit.) | [Boiling point ]
280°C (rough estimate) | [density ]
2.0410 (rough estimate) | [refractive index ]
1.6000 (estimate) | [pka]
-6.03±0.25(Predicted) | [InChI]
1S/C6H4ClN3O4/c7-3-1-4(9(11)12)6(8)5(2-3)10(13)14/h1-2H,8H2 | [InChIKey]
CLMQUEQFVUMDPC-UHFFFAOYSA-N | [SMILES]
Nc1c(cc(Cl)cc1[N+]([O-])=O)[N+]([O-])=O | [EPA Substance Registry System]
4-Chloro-2,6-dinitroaniline (5388-62-5) |
| Hazard Information | Back Directory | [Uses]
Standard molar enthalpy of formation of 4-chloro-2,6-dinitroaniline has been evaluated. | [General Description]
Standard molar enthalpy of formation of 4-chloro-2,6-dinitroaniline has been evaluated. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
SynAsst Chemical.
|
| Telephone: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-29-81139210 17389186172 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-219/ |
|