| Identification | Back Directory | [Name]
TRANS-9,10-DIHYDRO-9,10-ETHANOANTHRACENE-11,12-DIMETHANOL | [CAS]
5445-55-6 | [Synonyms]
trans-9,10-dihydro-9,10-ethanoanthracene-11,12-di TRANS-9,10-DIHYDRO-9,10-ETHANOANTHRACENE-11,12-DIMETHANOL 9,10-Ethanoanthracene-11,12-dimethanol, 9,10-dihydro-, (11R,12R)-rel- | [Molecular Formula]
C18H18O2 | [MDL Number]
MFCD00074950 | [MOL File]
5445-55-6.mol | [Molecular Weight]
266.33 |
| Chemical Properties | Back Directory | [Melting point ]
203-205 °C (lit.) | [Boiling point ]
453.9±25.0 °C(Predicted) | [density ]
1.212±0.06 g/cm3(Predicted) | [form ]
solid | [pka]
14.49±0.10(Predicted) | [InChI]
1S/C18H18O2/c19-9-15-16(10-20)18-12-6-2-1-5-11(12)17(15)13-7-3-4-8-14(13)18/h1-8,15-20H,9-10H2/t15-,16-,17?,18?/m1/s1 | [InChIKey]
JRUAWKGGVJZZQC-MRLCAUJQSA-N | [SMILES]
OC[C@@H]1[C@@H](CO)C2c3ccccc3C1c4ccccc24 |
| Hazard Information | Back Directory | [Uses]
trans-9,10-Dihydro-9,10-ethanoanthracene-11,12-dimethanol was employed in the synthesis of dibenzo[b,f]oxepin scaffolds via Ullmann-type etheration reaction. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|