| Identification | Back Directory | [Name]
1,7-NAPHTHYRIDIN-2(1H)-ONE | [CAS]
54920-82-0 | [Synonyms]
1,7-Naphthyridin-2(1H) 1H-1,7-naphthyridin-2-one 1,7-NAPHTHYRIDIN-2(1H)-ONE 1,3-Naphthyridine-2(1H)-one 1,2-dihydroquinazolin-2-one | [Molecular Formula]
C8H6N2O | [MDL Number]
MFCD11521584 | [MOL File]
54920-82-0.mol | [Molecular Weight]
146.15 |
| Chemical Properties | Back Directory | [Melting point ]
290-291 °C(Solv: water (7732-18-5)) | [Boiling point ]
391.8±42.0 °C(Predicted) | [density ]
1.267±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [pka]
11.27±0.20(Predicted) | [Appearance]
Light yellow to yellow Solid | [InChI]
InChI=1S/C8H6N2O/c11-8-2-1-6-3-4-9-5-7(6)10-8/h1-5H,(H,10,11) | [InChIKey]
FQAJSEWFBJSSOY-UHFFFAOYSA-N | [SMILES]
N1C2C(=CC=NC=2)C=CC1=O |
| Hazard Information | Back Directory | [Synthesis]
The general procedure for the synthesis of 2-hydroxy-1,7-naphthyridine from ethyl (E)-3-(3-aminopyridin-4-yl)acrylate was as follows:
1. Sodium metal (3.6 g, 156 mmol) was slowly added to anhydrous ethanol (300 mL) in batches under stirring, and after the sodium was completely dissolved, ethyl (E)-3-(3-aminopyridin-4-yl)acrylate (20 g, 104 mmol) was added.
2. The reaction mixture was stirred at 90 °C for 1 hour.
3. After completion of the reaction, the mixture was cooled to room temperature and subsequently concentrated under reduced pressure to remove the solvent.
4. The crude product was purified by silica gel column chromatography (eluent: dichloromethane/methanol=10/1) to afford the target compound 1,7-naphthyridin-2(1H)-one (10 g, yield: 66%) as a yellow solid. 5. The product was subjected to ESI-MRI analysis.
5. The product was detected by ESI-MS and showed a molecular ion peak (M + H)+ m/z of 147.1. 6. 1H NMR (1H NMR, 1H NMR, 1H NMR, 1H NMR) was performed.
6. 1H NMR (400 MHz, CDCl3) data were as follows: δ 8.76 (s, 1H), 8.46 (d, J=5.2 Hz, 1H), 7.78 (d, J=9.6 Hz, 1H), 7.44 (d, J=5.2 Hz, 1H), 6.90 (d, J=9.6 Hz, 1H). | [References]
[1] Patent: WO2018/140876, 2018, A1. Location in patent: Page/Page column 197 [2] Patent: EP1595881, 2005, A1. Location in patent: Page/Page column 58 [3] Patent: WO2018/83136, 2018, A1. Location in patent: Page/Page column 35 |
|
| Company Name: |
BioPharmaMatrix,Inc.
|
| Telephone: |
0510-86010668 13395169561; |
| Website: |
http://www.biopharmamatrix.com |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-58581007 18019463053 |
| Website: |
http://www.coolpharm.com.cn |
|