| Identification | Back Directory | [Name]
1-Methyl-1,2-dihydrocyclobutabenzene | [CAS]
55337-80-9 | [Synonyms]
1-Methyl-1,2-dihydrocyclobutabenzene 7-methylbicyclo[4.2.0]octa-1,3,5-triene Bicyclo[4.2.0]octa-1,3,5-triene, 7-methyl- | [Molecular Formula]
C9H10 | [MDL Number]
MFCD01846105 | [MOL File]
55337-80-9.mol | [Molecular Weight]
118.18 |
| Chemical Properties | Back Directory | [Boiling point ]
85-105 °C(Press: 105 Torr) | [density ]
0.978±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C9H10/c1-7-6-8-4-2-3-5-9(7)8/h2-5,7H,6H2,1H3 | [InChIKey]
DIIIHASDQIQOFX-UHFFFAOYSA-N | [SMILES]
C12C(C(C)C1)=CC=CC=2 | [LogP]
2.34620 |
| Hazard Information | Back Directory | [Uses]
1-Methyl-1,2-dihydrocyclobutabenzene belongs to the benzocyclobutene (BCB) series of compounds; its structural features include a BCB active group and a methyl substituent. This compound is primarily used in research into perfluorinated BCBs and their derivatives. |
|
| Company Name: |
nanjing
|
| Telephone: |
13376084917 13376082704 |
| Website: |
www.linye-e.com/ |
|