| Identification | Back Directory | [Name]
NICOTINAMIDE GUANINE DINUCLEOTIDE SODIUM SALT | [CAS]
5624-35-1 | [Synonyms]
nicotinamide guanine dinucleotide nicotinamide guanine dinucleotide*sodium NICOTINAMIDE GUANINE DINUCLEOTIDE SODIUM SALT Nicotinamide guanine dinucleotide sodium salt phospodiesterase and ADP-ribosyl cyclase substrate [[5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate | [Molecular Formula]
C21H27N7O15P2 | [MDL Number]
MFCD00079505 | [MOL File]
5624-35-1.mol | [Molecular Weight]
679.42 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
H2O: soluble-50 mg/mL, clear, almost colorless to slightly yellow | [form ]
powder | [InChIKey]
WWXCUPZEUROLRY-UHFFFAOYSA-N | [SMILES]
NC(=O)C1=CC=C[N](=C1)C2OC(COP(O)(=O)OP(O)(=O)OCC3OC(C(O)C3O)n4cnc5C(=O)N=C(N)Nc45)C(O)C2O |
| Hazard Information | Back Directory | [Uses]
Nicotinamide guanine dinucleotide sodium salt has been used as a substrate for measuring the cyclase activity of the enzyme cluster of differentiation 38 (CD38). It has also been used as a substrate to fluorometrically determine the activity of CD38/ADP-ribose (ADPR). | [Biochem/physiol Actions]
Nicotinamide guanine dinucleotide sodium salt is used to determine the activity of proteins that generate cyclic-ADP-ribose (cADPR) in the ADP-ribosyl cyclase family. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
|