| Identification | Back Directory | [Name]
2-Methoxy-1-acetonaphthone | [CAS]
5672-94-6 | [Synonyms]
2-Methoxy-1-acetonaphthone 1-Acetyl-2-methoxynaphthalene 1-(2-Methoxynaphthalen-1-yl)ethan-1-one Ethanone, 1-(2-methoxy-1-naphthalenyl)- | [Molecular Formula]
C13H12O2 | [MDL Number]
MFCD11553477 | [MOL File]
5672-94-6.mol | [Molecular Weight]
200.23 |
| Chemical Properties | Back Directory | [Melting point ]
58 °C | [Boiling point ]
158 °C/2 mmHg | [storage temp. ]
Store at room temperature | [solubility ]
soluble in Toluene | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C13H12O2/c1-9(14)13-11-6-4-3-5-10(11)7-8-12(13)15-2/h3-8H,1-2H3 | [InChIKey]
WFBBDKXOGOJOKY-UHFFFAOYSA-N | [SMILES]
C(=O)(C1=C2C(C=CC=C2)=CC=C1OC)C |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|