| Identification | Back Directory | [Name]
3,4-diacetoxystyrene | [CAS]
57142-64-0 | [Synonyms]
3,4-diacetoxystyrene
1,2-Benzenediol, 4-ethenyl-, 1,2-diacetate | [Molecular Formula]
C12H12O4 | [MOL File]
57142-64-0.mol | [Molecular Weight]
220.22 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C12H12O4/c1-4-10-5-6-11(15-8(2)13)12(7-10)16-9(3)14/h4-7H,1H2,2-3H3 | [InChIKey]
BGDWDFVUSUCDHI-UHFFFAOYSA-N | [SMILES]
C1(OC(=O)C)=CC=C(C=C)C=C1OC(=O)C |
| Hazard Information | Back Directory | [Uses]
3,4-diacetoxystyrene can serve as a fluorescent or linking group and participate in the synthesis of various anti-tumor drugs. For example, it can promote tumour cell death by binding to DNA or serve as a fluorescent probe for tumour cell imaging. 3,4-diacetoxystyrene plays an essential role in the synthesis of anti-inflammatory drugs. It can serve as a structural template for osteoporosis drugs, enhancing their anti-inflammatory activity by modifying their substituents or introducing double bonds. |
|
|