| Identification | Back Directory | [Name]
3,4-diacetoxystyrene | [CAS]
57142-64-0 | [Synonyms]
3,4-diacetoxystyrene
1,2-Benzenediol, 4-ethenyl-, 1,2-diacetate | [Molecular Formula]
C12H12O4 | [MOL File]
57142-64-0.mol | [Molecular Weight]
220.22 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C12H12O4/c1-4-10-5-6-11(15-8(2)13)12(7-10)16-9(3)14/h4-7H,1H2,2-3H3 | [InChIKey]
BGDWDFVUSUCDHI-UHFFFAOYSA-N | [SMILES]
C1(OC(=O)C)=CC=C(C=C)C=C1OC(=O)C |
| Hazard Information | Back Directory | [Uses]
3,4-diacetoxystyrene can serve as a fluorescent or linking group and participate in the synthesis of various anti-tumor drugs. For example, it can promote tumour cell death by binding to DNA or serve as a fluorescent probe for tumour cell imaging. 3,4-diacetoxystyrene plays an essential role in the synthesis of anti-inflammatory drugs. It can serve as a structural template for osteoporosis drugs, enhancing their anti-inflammatory activity by modifying their substituents or introducing double bonds. | [Synthesis Reference(s)]
[1] The preparation method of one kind 3,4- diacetoxy styrene. CN108129318A | [Materials Uses]
3,4-diacetoxystyrene is a kind of aromatic compound with potential practicability, and is an important polymer monomer, which can be used for the preparation of resins, coatings, electronic materials, etc. | [Synthesis]
the preparation method of 3,4-diacetoxystyrene comprising: at a temperature of 60-70°C, 3,4-dihydroxybenzaldehyde and malonic acid in at least one organic solvent React under the condition that and catalyst exists, generate the first reaction mixture that comprises 3,4-dihydroxycinnamic acid; Be heated up to 80-90 ℃, make the first reaction mixture continue to react, generate the first reaction mixture that comprises 3,4-dihydroxystyrene The second reaction mixture; the second reaction mixture is purified to obtain 3,4-diacetoxystyrene; at a temperature of 10-20°C, 3,4-dihydroxystyrene reacts with an acetylating reagent to generate 3,4-dihydroxystyrene A third reaction mixture of diacetoxystyrene; purification of the third reaction mixture yields 3,4-diacetoxystyrene.[1] |
|
| Company Name: |
AFINE CHEMICALS LIMITED
|
| Telephone: |
+86-571-85134551 +86-18958018566 |
| Website: |
www.afinechem.com/index.html |
|