| Identification | Back Directory | [Name]
KEMXOZSBCMOIEF-LECWWXJVSA-N | [CAS]
57171-18-3 | [Synonyms]
21-DEHYDRO DESONIDE Desonide-21-aldehyde Desonide Glyoxal Impurity KEMXOZSBCMOIEF-LECWWXJVSA-N Pregna-1,4-dien-21-al, 11-hydroxy-16,17-[(1-methylethylidene)bis(oxy)]-3,20-dioxo-, (11β,16α)- Desonide glyoxal (Hydrate form)Q: What is
Desonide glyoxal (Hydrate form) Q: What is the CAS Number of
Desonide glyoxal (Hydrate form) 2-((6aR,6bS,7S,8aS,8bS,11aR,12aS,12bS)-7-hydroxy-6a,8a,10,10-tetramethyl-4-oxo-1,2,4,6a,6b,7,8,8a,11a,12,12a,12b-dodecahydro-8bH-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-8b-yl)-2-oxoacetaldehyde Desonide glyoxal( Mixture of aldehyde and hydrate form)Q: What is
Desonide glyoxal( Mixture of aldehyde and hydrate form) Q: What is the CAS Number of
Desonide glyoxal( Mixture of aldehyde and hydrate form) Q: What is the storage condition of
Desonide glyoxal( Mixture of aldehyde and hydrate form) Q: What are the applications of
Desonide glyoxal( Mixture of aldehyde and hydrate form) | [Molecular Formula]
C24H30O6 | [MOL File]
57171-18-3.mol | [Molecular Weight]
414.49 |
| Chemical Properties | Back Directory | [Boiling point ]
552.2±50.0 °C(Predicted) | [density ]
1.29±0.1 g/cm3(Predicted) | [pka]
14.21±0.70(Predicted) | [InChIKey]
KEMXOZSBCMOIEF-JGHJVBRBSA-N | [SMILES]
C1(=O)C=C2[C@](C)(C=C1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](C[C@@H]1O)(C)[C@@]1(OC(O[C@@]1([H])C3)(C)C)C(=O)C=O)CC2 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|