| Identification | Back Directory | [Name]
2,4,6-Tris(4-methoxyphenyl)pyrylium tetrafluoroborate | [CAS]
580-34-7 | [Synonyms]
2,4,6-Tris(4-methoxyphenyl)pyrylium tetrafluoroborate
2,4,6-Tris(4-methoxyphenyl)pyrylium tetrafluoroborate >=95% | [Molecular Formula]
C26H23BF4O4 | [MDL Number]
MFCD00160229 | [MOL File]
580-34-7.mol | [Molecular Weight]
486.263 |
| Chemical Properties | Back Directory | [Melting point ]
346-351°C | [storage temp. ]
under inert gas (nitrogen or Argon) at 2–8 °C | [form ]
powder | [Appearance]
Orange to red Solid | [InChI]
1S/C26H23O4.BF3.FH/c1-27-22-10-4-18(5-11-22)21-16-25(19-6-12-23(28-2)13-7-19)30-26(17-21)20-8-14-24(29-3)15-9-20;2-1(3)4;/h4-17H,1-3H3;;1H/q+1;;/p-1 | [InChIKey]
BYUPZXIJGVBLGP-UHFFFAOYSA-M | [SMILES]
COC(C=C1)=CC=C1C2=[O+]C(C3=CC=C(OC)C=C3)=CC(C4=CC=C(OC)C=C4)=C2.FB(F)F.[F-] |
| Safety Data | Back Directory | [WGK Germany ]
WGK 3 | [Storage Class]
11 - Combustible Solids | [Hazard Classifications]
Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Hazard Information | Back Directory | [Uses]
2,4,6-Tris(4-methoxyphenyl)pyrylium tetrafluoroborate can be used to catalyze the stereoselective synthesis of C2-symmetric cyclobutane alkene dimers via photo-induced electron transfer. This method can be employed for the total synthesis of lignans such as magnosalin, endiandrin A and pellucidin A. It can also catalyze photoinduced electron transfer (PET) to initiate radical-cation Diels-Alder reactions. | [reaction suitability]
reagent type: catalyst
reaction type: Photocatalysis |
|
| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-1332688 18019345275 |
| Website: |
https://www.rhawn.cn/ |
| Company Name: |
G-CLONE
|
| Tel: |
400-910-1997 15330005590 |
| Website: |
http://www.g-clone.com/ |
|