| Identification | Back Directory | [Name]
BalipraMine Hydrochloride (IMpurity) | [CAS]
58262-51-4 | [Synonyms]
Depramine Impurity
Imipramine EP Impurity B
Balipramine Hydrochloride
IMIPRAMINE HYDROCHLORIDE IMPURITY B
BalipraMine Hydrochloride (IMpurity)
Imipramine Impurity 2（Imipramine EP Impurity B）
3-(5H-Dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine (depramine) Hydrochloride | [Molecular Formula]
C19H22N2 | [MDL Number]
MFCD01752434 | [MOL File]
58262-51-4.mol | [Molecular Weight]
278.391 |
| Chemical Properties | Back Directory | [Melting point ]
176-177 °C | [storage temp. ]
-20°C Freezer | [solubility ]
Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [color ]
Yellow to Very Dark Yellow | [Major Application]
pharmaceutical (small molecule) | [InChI]
1S/C19H22N2.ClH/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21;/h3-6,8-13H,7,14-15H2,1-2H3;1H | [InChIKey]
QHOQDRVNCMCLDK-UHFFFAOYSA-N | [SMILES]
Cl.[n]1(c2c(ccc3c1cccc3)cccc2)CCCN(C)C |
| Hazard Information | Back Directory | [Uses]
Balipramine Hydrochloride is a tricyclic anti-depressant compound. This is the salt form of Balipramine (Depramine), which has shown clinical antidepressant activity. Also known as imipramine impurity B. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|