| Identification | Back Directory | [Name]
2-benzoquinone | [CAS]
583-63-1 | [Synonyms]
o-Quinone Chebi:17253 2-benzoquinone 1,2-BENZOQUINONE Norepinephrine Impurity 33 Cyclohexa-3,5-diene-1,2-dione | [Molecular Formula]
C6H4O2 | [MDL Number]
MFCD01663117 | [MOL File]
583-63-1.mol | [Molecular Weight]
108.09 |
| Chemical Properties | Back Directory | [Melting point ]
65°C (rough estimate) | [Boiling point ]
162.69°C (rough estimate) | [density ]
1.1860 (rough estimate) | [refractive index ]
1.5017 (estimate) | [form ]
Solid | [InChI]
InChI=1S/C6H4O2/c7-5-3-1-2-4-6(5)8/h1-4H | [InChIKey]
WOAHJDHKFWSLKE-UHFFFAOYSA-N | [SMILES]
C1(=O)C=CC=CC1=O |
| Hazard Information | Back Directory | [Definition]
ChEBI: A benzoquinone resulting from the formal oxidation of catechol. | [Safety Profile]
A poison. Mutation data reported.When heated to decomposition it emits acrid smoke andirritating fumes. |
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-61855200 13326451905 |
| Website: |
www.toref.cn/ |
|