| Identification | Back Directory | [Name]
2,6,14-triaminotriptycene | [CAS]
58519-06-5 | [Synonyms]
2,6,14-triaminotriptycene 9,10-Dihydro-9,10-[1,2]benzenoanthracene-2,6,14-triamine 9,10[1',2']-Benzenoanthracene-2,6,14-triamine, 9,10-dihydro- | [Molecular Formula]
C20H17N3 | [MDL Number]
MFCD34475984 | [MOL File]
58519-06-5.mol | [Molecular Weight]
299.38 |
| Chemical Properties | Back Directory | [Melting point ]
279-283 °C (decomp) | [Boiling point ]
534.7±50.0 °C(Predicted) | [density ]
1.365±0.06 g/cm3(Predicted) | [pka]
5.20±0.20(Predicted) | [InChI]
InChI=1S/C20H17N3/c21-10-3-6-15-16(7-10)19-13-4-1-11(22)8-17(13)20(15)18-9-12(23)2-5-14(18)19/h1-9,19-20H,21-23H2 | [InChIKey]
CKKNNPPUUXLVDT-UHFFFAOYSA-N | [SMILES]
NC1=CC=C2C3C4=CC(N)=CC=C4C(C4=CC=C(N)C=C43)C2=C1 |
| Hazard Information | Back Directory | [Uses]
2,6,14-Triaminotriptycene is used as a monomer for the synthesis of COF materials: ALP-1; TB-MOP; HF-MOP; PDI-Tc; NDI-Tc; HT-PA-1-4. |
|
| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Telephone: |
021-021-021-67601398-809-809-809 15221380277 |
| Website: |
www.spectrumchemical.com/oa_html/index.jsp?minisite=10020&respid=22372&language=us |
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Telephone: |
0371-55055611 18137792234 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList31206/0.htm |
|