| Chemical Properties | Back Directory | [Melting point ]
212-214 °C(Solv: water (7732-18-5)) | [form ]
Solid | [color ]
White to off-white | [InChI]
InChI=1/C10H12N8O3/c11-8-6-9(14-2-13-8)18(3-15-6)10-7(20)5(16-17-12)4(1-19)21-10/h2-5,7,10,19-20H,1H2,(H2,11,13,14)/t4-,5-,7-,10-/s3 | [InChIKey]
HTWSTKVLFZRAPM-RLCZZNSNNA-N | [SMILES]
OC[C@H]1O[C@@H](N2C3=C(C(=NC=N3)N)N=C2)[C@H](O)[C@@H]1N=[N+]=[N-] |&1:2,4,15,17,r| |
| Hazard Information | Back Directory | [Uses]
3′-Azido-3′-deoxyAdenosine is a useful research chemical compound used in the preparation and general synthesis of purine (amino, azido, and triflate)??-??sugar nucleosides. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Website: |
www.enzo.com |
|