| Identification | Back Directory | [Name]
1-(3,4-dimethoxybenzyl)-3,4-dihydro-6,7-dimethoxyisoquinolinium chloride | [CAS]
5884-22-0 | [Synonyms]
DIHYDROALKALI HYDROCHLORIDE LRUSBWIBSILYNE-UHFFFAOYSA-N 3,4-Dihydropapaverine HCl (DPH) Papaverine EP Impurity C HCl (3,4-Dihydropapaverine HCl) 1-(3,4-dimethoxybenzyl)-3,4-dihydro-6,7-dimethoxyisoquinolin... 1-(3,4-dimethoxybenzyl)-3,4-dihydro-6,7-dimethoxyisoquinolinium chloride 1-[(3,4-diMethoxyphenyl)Methyl]-6,7-diMethoxy-3,4-dihydroisoquinoline hydrochloride | [EINECS(EC#)]
227-560-0 | [Molecular Formula]
C20H24ClNO4 | [MDL Number]
MFCD00192866 | [MOL File]
5884-22-0.mol | [Molecular Weight]
377.862 |
| Chemical Properties | Back Directory | [Melting point ]
202℃ | [InChI]
InChI=1S/C20H23NO4.ClH/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16;/h5-6,10-12H,7-9H2,1-4H3;1H | [InChIKey]
LRUSBWIBSILYNE-UHFFFAOYSA-N | [SMILES]
C12C=C(C(OC)=CC=1CCN=C2CC1C=CC(OC)=C(OC)C=1)OC.Cl |
| Questions And Answer | Back Directory | [Uses]
Dihydropopapaverine hydrochloride can be used as an important intermediate in the synthesis of the highly effective muscle relaxant atracurium cis-benzenesulfonate. |
|
| Company Name: |
Nanjing Yiyuan Gold
|
| Telephone: |
18915107665 18061915908 |
| Website: |
|
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
|