| Identification | Back Directory | [Name]
4-BENZYLOXY-3-CHLOROANILINE 96 | [CAS]
59404-86-3 | [Synonyms]
Lapatinib impurity C 3-chloro-4-phenylmethoxyaniline 4-BENZYLOXY-3-CHLOROANILINE 96 4-Benzyloxy-3-chloroaniline 95% 4-(benzyloxy)-3-chlorobenzenamine 3-Chloro-4-(phenylmethoxy)benzenamine BenzenaMine, 3-chloro-4-(phenylMethoxy)- | [Molecular Formula]
C13H12ClNO | [MDL Number]
MFCD03427265 | [MOL File]
59404-86-3.mol | [Molecular Weight]
233.69 |
| Chemical Properties | Back Directory | [Melting point ]
56-60 °C (lit.) | [Boiling point ]
390.6±27.0 °C(Predicted) | [density ]
1.240±0.06 g/cm3(Predicted) | [form ]
solid | [pka]
4.10±0.10(Predicted) | [InChI]
1S/C13H12ClNO/c14-12-8-11(15)6-7-13(12)16-9-10-4-2-1-3-5-10/h1-8H,9,15H2 | [InChIKey]
WOWKZTBVWKKGJV-UHFFFAOYSA-N | [SMILES]
Nc1ccc(OCc2ccccc2)c(Cl)c1 |
| Hazard Information | Back Directory | [Uses]
4-Benzyloxy-3-chloroaniline is a compound used in the preparation of potent and selective inhibitors for UBLCP1 proteasome phosphatase. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-029-81138252 +86-173 9270 1263 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-222/ |
|