| Identification | Back Directory | [Name]
(+)-ALPHA-LONGIPINENE | [CAS]
5989-08-2 | [Synonyms]
(+)-α-longipinene Longipinene (>80%) (+)-alfa-Longipinene (+)-ALPHA-LONGIPINENE (+)-ALPHA-LONGIPINENE 97.0% (sum of enantiomers, GC) 2,6,6,9-Tetramethyl-tricyclo[5.4.0.0(2,8)]undec-9-ene (+)-alpha-Longipinene >=99.0% (sum of enantiomers, GC) Tricyclo[5.4.0.0(2,8)]undec-9-ene, 2,6,6,9-tetramethyl- Tricyclo[5.4.0.0(2,8)]undec-9-ene, 3,3,7,9-tetramethyl- (1R,2S,7R,8R)-2,6,6,9-TETRAMETHYL-TRICYCLO[5.4.0.0(2.8)]UNDEC-9-ENE Tricyclo[5.4.0.02,8]undec-9-ene, 2,6,6,9-tetramethyl-, (1R,2S,7R,8R)- α-longipineneQ: What is
α-longipinene Q: What is the CAS Number of
α-longipinene | [Molecular Formula]
C15H24 | [MDL Number]
MFCD00077624 | [MOL File]
5989-08-2.mol | [Molecular Weight]
204.35 |
| Chemical Properties | Back Directory | [Boiling point ]
244-246 °C(lit.) | [density ]
0.915 g/mL at 20 °C(lit.) | [refractive index ]
n20/D 1.493 | [Fp ]
92℃ | [storage temp. ]
2-8°C | [solubility ]
Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | [form ]
Oil | [color ]
Colourless | [Optical Rotation]
[α]20/D +25±1°, neat | [Stability:]
Light Sensitive | [InChI]
1S/C15H24/c1-10-6-7-11-13-12(10)15(11,4)9-5-8-14(13,2)3/h6,11-13H,5,7-9H2,1-4H3/t11-,12+,13+,15-/m1/s1 | [InChIKey]
HICYDYJTCDBHMZ-UKTARXLSSA-N | [SMILES]
[H][C@@]12CC=C(C)[C@@]3([H])[C@@]1([H])C(C)(C)CCC[C@]23C | [LogP]
6.398 (est) |
| Hazard Information | Back Directory | [Uses]
(+)-α-Longipinene can be used as a starting material for the synthesis of new terpenoids, (+)-(5S)-5,12-dihydroxy-α-longipinene, (-)-(5R)-5,12-dihydroxy-α-longipinene, and (+)-12-hydroxy-α-longipinen-5-one by oxidation reaction using Aspergillus niger as a biocatalyst. It can be oxidized using lead tetraacetate into tertiary alcohol, longi-cis-verbenol, longi-trans-verbenol, longi-cis-β-crysanthenol, longiverbenone, longi-trans- β -crysanthenol, 2 β,3 β -dihydroxylongipinane, 4 α,8-dihydroxy- α -Iongipinene, and 4 β,8-dihydroxy- α -longipinene. | [Definition]
ChEBI: A bridged compound and sesquiterpene that is tricyclo[5.4.0.02,8]undecane that is substituted by methyl groups at the 2, 6, 6, and 9 positions and has a double bond between positions 9 and 10. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|