| Identification | Back Directory | [Name]
ethyl 5-aMino-2-chloropyriMidine-4-carboxylate | [CAS]
59950-50-4 | [Synonyms]
ethyl 5-aMino-2-chloropyriMidine-4-carboxylate
4-Pyrimidinecarboxylic acid, 5-amino-2-chloro-, ethyl ester | [Molecular Formula]
C7H8ClN3O2 | [MDL Number]
MFCD22377545 | [MOL File]
59950-50-4.mol | [Molecular Weight]
201.61 |
| Chemical Properties | Back Directory | [Melting point ]
155 °C | [Boiling point ]
376.8±22.0 °C(Predicted) | [density ]
1.395±0.06 g/cm3(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2–8 °C | [pka]
-2.13±0.10(Predicted) | [InChI]
InChI=1S/C7H8ClN3O2/c1-2-13-6(12)5-4(9)3-10-7(8)11-5/h3H,2,9H2,1H3 | [InChIKey]
BNFCEIMRFKQNND-UHFFFAOYSA-N | [SMILES]
C1(Cl)=NC=C(N)C(C(OCC)=O)=N1 |
| Hazard Information | Back Directory | [Synthesis]
Ethyl 2,6-Dichloro-5-nitropyrimidine-4-carboxylate could be used to synthesis ethyl 5-aMino-2-chloropyriMidine-4-carboxylate.
|
|
|