| Identification | Back Directory | [Name]
(1R,4S)-CIS-4-ACETOXY-2-CYCLOPENTEN-1-OL | [CAS]
60176-77-4 | [Synonyms]
4-Cyclopentene-1,3-diol, 1-acetate (1R,4S)-CIS-4-ACETOXY-2-CYCLOPENTEN-1-OL (1S,3R)-4-Cyclopentene-1,3-Diol 1-Acetate (1S,4R)-4-HYDROXYCYCLOPENT-2-ENYL ACETATE 4-Cyclopentene-1,3-diol,1-acetate, (1S,3R)- (1S,4R)-CIS-4-HYDROXY-2-CYCLOPENTENYL ACETATE (1R,4S)-cis-4-Acetoxy-2-cyclopenten-1-ol >=98.0% (sum of enantiomers, GC) | [Molecular Formula]
C7H10O3 | [MDL Number]
MFCD00210003 | [MOL File]
60176-77-4.mol | [Molecular Weight]
142.15 |
| Chemical Properties | Back Directory | [Melting point ]
49-51 °C | [storage temp. ]
Store at +2°C to +8°C. | [Optical Rotation]
[α]20/D -67±2°, c =2.3% in chloroform | [InChI]
1S/C7H10O3/c1-5(8)10-7-3-2-6(9)4-7/h2-3,6-7,9H,4H2,1H3/t6-,7+/m0/s1 | [InChIKey]
IJDYOKVVRXZCFD-NKWVEPMBSA-N | [SMILES]
CC(=O)O[C@H]1C[C@@H](O)C=C1 |
| Hazard Information | Back Directory | [Uses]
(1R,4S)-cis-4-Acetoxy-2-cyclopenten-1-ol can be used as a reactant in the total synthesis of Bartlett′s brefeldin intermediate, spinosyn A analogs, (+)-7-deaza-5′-noraristeromycin, (±) strychnine and the Wieland-Gumlich aldehyde. |
|
| Company Name: |
SynAsst Chemical.
|
| Tel: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
CHIRIAL CO.LTD
|
| Tel: |
19941513806 |
| Website: |
www.chirial.com |
|