| Identification | Back Directory | [Name]
2,3,6-TRINITROPHENOL | [CAS]
603-10-1 | [Synonyms]
2,3,6-TRINITROPHENOL 2,3,6-TRINITROPHENOL (WITH 0,4 ML H2O/G) 2,3,6-trinitrophenol moistened with water (H2O ~40%) 2,3,6-Trinitrophenol moistened with water, >=95.0% (calc. based on dry substance, HPLC) | [EINECS(EC#)]
201-865-9 | [Molecular Formula]
C6H3N3O7 | [MDL Number]
MFCD00043147 | [MOL File]
603-10-1.mol | [Molecular Weight]
229.1 |
| Chemical Properties | Back Directory | [Melting point ]
119-120 °C(lit.)
| [InChI]
1S/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H | [InChIKey]
UPOHJPYGIYINKG-UHFFFAOYSA-N | [SMILES]
Oc1c(ccc(c1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O |
| Hazard Information | Back Directory | [Uses]
2,3,6-Trinitrophenol is a useful reactant and reagent in organic reactions. | [Definition]
ChEBI: 2,3,6-trinitrophenol is phenol substituted with nitro groups at both ortho-positions and at the meta-position. It is functionally related to a phenol. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|