| Identification | Back Directory | [Name]
3-BENZYLOXY-BENZOYL CHLORIDE | [CAS]
61535-46-4 | [Synonyms]
AKOS BB-8604 ASISCHEM B52694 ZERENEX E/4047709 ART-CHEM-BB B025597 LABOTEST-BB LT00511886 3-BENZYLOXY-BENZOYL CHLORIDE 3-Benzyloxybenzoyl chloride 94% 3-Benzyloxybenzoic acid chloride 3-(phenylmethoxy)benzoyl chloride benzoyl chloride, 3-(phenylmethoxy)- | [Molecular Formula]
C14H11ClO2 | [MDL Number]
MFCD02258040 | [MOL File]
61535-46-4.mol | [Molecular Weight]
246.69 |
| Chemical Properties | Back Directory | [Melting point ]
40-42℃ | [Fp ]
>110℃ | [form ]
solid | [Water Solubility ]
Reacts with water. | [Sensitive ]
Moisture Sensitive | [InChI]
1S/C14H11ClO2/c15-14(16)12-7-4-8-13(9-12)17-10-11-5-2-1-3-6-11/h1-9H,10H2 | [InChIKey]
HPVUGOBQRQUWMK-UHFFFAOYSA-N | [SMILES]
ClC(=O)c1cccc(OCc2ccccc2)c1 |
| Hazard Information | Back Directory | [Uses]
Reactant for preparation of dihydroquinolinones and tetrahydroquinazolinones as potent kinesin spindle protein inhibitors and potential antitumor agents, preparation of carbamate derivatives as fatty acid amide hydrolase inhibitors. | [Uses]
Reactant for:
- Preparation of dihydroquinolinones and tetrahydroquinazolinones as potent kinesin spindle protein inhibitors and potential antitumor agents
- Preparation of carbamate derivatives as fatty acid amide hydrolase inhibitors
|
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|