| Identification | Back Directory | [Name]
2-Bromodiphenylamine | [CAS]
61613-22-7 | [Synonyms]
2-BDPA 2-Bromodiphenylamine 2-bromo-n-phenylaniline N-(2-Bromophenyl)aniline 2-bromo-N-phenylbenzenamine Benzenamine, 2-bromo-N-phenyl- | [Molecular Formula]
C12H10BrN | [MDL Number]
MFCD01851817 | [MOL File]
61613-22-7.mol | [Molecular Weight]
248.119 |
| Chemical Properties | Back Directory | [Melting point ]
49 °C | [Boiling point ]
323.2±25.0 °C(Predicted) | [density ]
1.445±0.06 g/cm3(Predicted) | [refractive index ]
1.66 | [storage temp. ]
Keep in dark place,Inert atmosphere,Room temperature | [form ]
clear liquid | [pka]
-1.00±0.20(Predicted) | [color ]
Colorless to Red to Green | [InChI]
InChI=1S/C12H10BrN/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9,14H | [InChIKey]
WAAWAHYRHUWAFM-UHFFFAOYSA-N | [SMILES]
C1(NC2=CC=CC=C2)=CC=CC=C1Br |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
AAB-PHARMA LIMITED
|
| Telephone: |
025-66800956 18800000000 |
| Website: |
http://www.njdmchem.com/ |
|