| Identification | Back Directory | [Name]
DI-BETA-D-XYLOPYRANOSYLAMINE | [CAS]
62983-70-4 | [Synonyms]
DI-B-D-XYLOPYRANOSYLAMINE di(β-d-xylopyranosyl)amine Di(β-D-xylopyranosyl)amine DI-SS-D-XYLOPYRANOSYL AMINE DI-BETA-D-XYLOPYRANOSYLAMINE Di(beta-D-xylopyranosyl)amine ~95% β-D-Xylopyranosylamine, N-β-D-xylopyranosyl- N-beta-D-Xylopyranosyl-beta-D-xylopyranosylamine | [Molecular Formula]
C10H19NO8 | [MDL Number]
MFCD00133264 | [MOL File]
62983-70-4.mol | [Molecular Weight]
281.26 |
| Chemical Properties | Back Directory | [Melting point ]
154-155℃ | [Boiling point ]
579.7±50.0 °C(Predicted) | [density ]
1.68±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
H2O: 50 mg/mL, clear, yellow | [form ]
powder | [pka]
12.98±0.70(Predicted) | [BRN ]
3908092 | [InChI]
1S/C10H19NO8/c12-3-1-18-9(7(16)5(3)14)11-10-8(17)6(15)4(13)2-19-10/h3-17H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-/m1/s1 | [InChIKey]
WDQLRJPDYLYTMJ-IJNKSVJISA-N | [SMILES]
O[C@@H]1CO[C@@H](N[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| Hazard Information | Back Directory | [Uses]
Di(β-D-xylopyranosyl)amine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Alfa Chemistry
|
| Tel: |
+1 (201) 478-8534 |
| Website: |
www.alfa-chemistry.com |
| Company Name: |
CarboMer, Inc.
|
| Tel: |
858 552 0992 |
| Website: |
www.carbomer.com |
|