| Identification | Back Directory | [Name]
Phenethyl trans-cinnamate | [CAS]
63238-64-2 | [Synonyms]
Phenethyl (E)-Cinnamate trans-Phenethyl cinnaMate Phenethyl trans-cinnamate 2-Phenylethyl (E)-Cinnamate (E)-Phenethyl 3-phenylacrylate trans-Phenethyl cinnaMate Cinnamic acid 2-phenylethyl ester (E)-Cinnamic Acid Phenethyl Ester (E)-Cinnamic Acid 2-Phenylethyl Ester (E)-3-Phenylpropenoic acid phenethyl ester 2-Propenoic acid, 3-phenyl-, 2-phenylethyl ester, (2E)- | [Molecular Formula]
C17H16O2 | [MDL Number]
MFCD00022050 | [MOL File]
63238-64-2.mol | [Molecular Weight]
252.31 |
| Chemical Properties | Back Directory | [Melting point ]
54-56 °C | [Boiling point ]
405.9±24.0 °C(Predicted) | [density ]
1.108±0.06 g/cm3(Predicted) | [solubility ]
soluble in Methanol | [form ]
powder to crystal | [color ]
White to Light yellow | [InChI]
InChI=1S/C17H16O2/c18-17(12-11-15-7-3-1-4-8-15)19-14-13-16-9-5-2-6-10-16/h1-12H,13-14H2/b12-11+ | [InChIKey]
MJQVZIANGRDJBT-VAWYXSNFSA-N | [SMILES]
C(OCCC1=CC=CC=C1)(=O)/C=C/C1=CC=CC=C1 |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 |
| Website: |
https://www.weikeqi-biotech.com/ |
|