| Identification | Back Directory | [Name]
S(-)-BACLOFEN HCL | [CAS]
63701-56-4 | [Synonyms]
S(-)-BACLOFEN HCL l-baclofenhydrochloride (-)-baclofenhydrochloride S(-)-BACLOFENHYDROCHLORIDE(FORR&DONLY) (-)-s-3-(p-chlorophenyl)-4-aminobutanoicacidhydrochloride (3S)-4-Amino-3-(4-chlorophenyl)butyric acid hydrochloride beta-(aminomethyl)-p-chloro-,hydrochloride,(s)-hydrocinnamicaci s(-)-β-(aminomethyl)-4-chlorobenzenepropanoic acid hydrochloride beta-(aminomethyl)-4-chloro-,hydrochloride,(s)-benzenepropanoicaci | [Molecular Formula]
C10H13Cl2NO2 | [MDL Number]
MFCD00078580 | [MOL File]
63701-56-4.mol | [Molecular Weight]
250.122 |
| Chemical Properties | Back Directory | [Melting point ]
194-195 °C(Solv: methanol (67-56-1)) | [solubility ]
DMSO: >20 mg/mL | [form ]
solid | [color ]
white | [Optical Rotation]
[α]28/D 2.2°, c = 0.9 in methanol(lit.) | [InChI]
1S/C10H12ClNO2.ClH/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14;/h1-4,8H,5-6,12H2,(H,13,14);1H/t8-;/m1./s1 | [InChIKey]
WMNUVYYLMCMHLU-DDWIOCJRSA-N | [SMILES]
Cl[H].NC[C@@H](CC(O)=O)c1ccc(Cl)cc1 |
| Safety Data | Back Directory | [RIDADR ]
UN 2811 6.1/PG 3 | [WGK Germany ]
3 | [RTECS ]
MW5084400 | [Storage Class]
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Information | Back Directory | [Uses]
S(-)-Baclofen Hydrochloride is a GABAB receptor agonist. Also, it is an effective antagonist of muscimol. | [Biochem/physiol Actions]
S(?)-Baclofen hydrochloride is a less active enantiomer of baclofen. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|