| Identification | Back Directory | [Name]
1-BROMO-2-FLUOROCYCLOHEXANE | [CAS]
656-57-5 | [Synonyms]
1-BROMO-FLUOROCYCLOHEXANE 1-BROMO-2-FLUOROCYCLOHEXANE 1-bromo-1-fluorocyclohexane 1β-Fluoro-2α-bromocyclohexane 1-Bromo-2-fluorocyclohexane> Cyclohexane, 1-bromo-2-fluoro- 1-BROMO-2-FLUOROCYCLOHEXANE ISO 9001:2015 REACH | [Molecular Formula]
C6H10BrF | [MDL Number]
MFCD01320789 | [MOL File]
656-57-5.mol | [Molecular Weight]
181.05 |
| Chemical Properties | Back Directory | [Boiling point ]
74.5-76.5/19mm | [density ]
1.46 | [refractive index ]
1.4800 and le 1.4840 | [form ]
clear liquid | [color ]
Colorless to Light orange to Yellow | [InChI]
InChI=1S/C6H10BrF/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2 | [InChIKey]
AZQRVGXSORXOCR-UHFFFAOYSA-N | [SMILES]
C1(Br)CCCCC1F | [CAS DataBase Reference]
656-57-5 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Maya High Purity Chemicals
|
| Tel: |
+86 (573) 82222445 (0)18006601000 452520369 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15221/0_EN.htm |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
|