| Identification | Back Directory | [Name]
Inchi=1/C14H11no2/C16-15(17)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/H1-11H/B7-6 | [CAS]
6624-53-9 | [Synonyms]
cis-4-Nitrostilbene (Z)-4-Nitrostilbene cis-4-Nitrostilbene 1-Nitro-4-[(E)-2-phenylvinyl]benzene Benzene, 1-nitro-4-[(E)-2-phenylethenyl]- Benzene, 1-nitro-4-[(1Z)-2-phenylethenyl]- Inchi=1/C14H11no2/C16-15(17)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/H1-11H/B7-6 | [Molecular Formula]
C14H11NO2 | [MDL Number]
MFCD16878988 | [MOL File]
6624-53-9.mol | [Molecular Weight]
225.24 |
| Chemical Properties | Back Directory | [Melting point ]
61.0 to 65.0 °C | [Boiling point ]
366.75°C (rough estimate) | [density ]
1.1508 (rough estimate) | [refractive index ]
1.5780 (estimate) | [solubility ]
soluble in Toluene | [form ]
powder to crystal | [color ]
Light yellow to Yellow to Green |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|