| Identification | Back Directory | [Name]
N,N-Bis(4-bromophenyl)-2,4,6-trimethylaniline | [CAS]
663943-27-9 | [Synonyms]
N,N-Bis(4-bromophenyl)-2,4,6-trimethylaniline Benzenamine, N,N-bis(4-bromophenyl)-2,4,6-trimethyl- | [Molecular Formula]
C21H19Br2N | [MDL Number]
MFCD30534245 | [MOL File]
663943-27-9.mol | [Molecular Weight]
445.19 |
| Chemical Properties | Back Directory | [Melting point ]
119.0 to 123.0 °C | [Boiling point ]
512.8±50.0 °C(Predicted) | [density ]
1.475±0.06 g/cm3(Predicted) | [solubility ]
soluble in Acetone | [form ]
powder to crystal | [pka]
-2.80±0.50(Predicted) | [color ]
White to Almost white | [InChI]
InChI=1S/C21H19Br2N/c1-14-12-15(2)21(16(3)13-14)24(19-8-4-17(22)5-9-19)20-10-6-18(23)7-11-20/h4-13H,1-3H3 | [InChIKey]
XZCBYXUKPMELOQ-UHFFFAOYSA-N | [SMILES]
C1(N(C2=CC=C(Br)C=C2)C2=CC=C(Br)C=C2)=C(C)C=C(C)C=C1C | [CAS DataBase Reference]
663943-27-9 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|