| Identification | Back Directory | [Name]
6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione | [CAS]
6642-29-1 | [Synonyms]
NSC 15356
5-Nitronaphthalic anhydride
4-Nitronaphthalic anhydride
4-Nitro-1,8-naphthalic anhydride 95%
6-nitro-1H,3H-naphtho[1,8-cd]pyran-1,3-dione
4-Nitro-1,8-naphthalenedicarboxylic anhydride
1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-nitro-
4-Nitro-1,8-naphthalic anhydride,4-Nitronaphthalene-1,8-dicarboxylic anhydride | [EINECS(EC#)]
229-659-4 | [Molecular Formula]
C12H5NO5 | [MDL Number]
MFCD00013446 | [MOL File]
6642-29-1.mol | [Molecular Weight]
243.17 |
| Chemical Properties | Back Directory | [Melting point ]
226-229 °C (lit.) | [Boiling point ]
509.9±33.0 °C(Predicted) | [density ]
1.637±0.06 g/cm3(Predicted) | [storage temp. ]
Inert atmosphere,Room Temperature | [form ]
powder | [color ]
Dark yellow | [BRN ]
237909 | [InChI]
1S/C12H5NO5/c14-11-7-3-1-2-6-9(13(16)17)5-4-8(10(6)7)12(15)18-11/h1-5H | [InChIKey]
LKOZHLXUWUBRDK-UHFFFAOYSA-N | [SMILES]
[O-][N+](=O)c1ccc2C(=O)OC(=O)c3cccc1c23 |
| Hazard Information | Back Directory | [Uses]
4-Nitro-1,8-naphthalic anhydride can be used:- As a precursor to synthesize N-phenyl-amino-1,8-naphthalimide based fluorescent chemosensor to detect nitro-antibiotics at ppb level.
- As a building block to synthesize shape memory polymers due to its ability to undergo Diels-Alder reaction
- As a fluorochrome substrate for nitrogen reductase for noninvasive hypoxia imaging in cancer detection.
- As a precursor to synthesize amphiphilic naphthalimide dyes with good color brilliancy.
|
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|