| Identification | Back Directory | [Name]
N-Methyl-N-(trifluoromethylthio)aniline | [CAS]
66476-44-6 | [Synonyms]
N-Methyl-N-(trifluoromethylthio)aniline N-Methyl-N-(trifluoromethylthio)aniline> N-Methyl-N-[(trifluoromethyl)sulfanyl]aniline N-Methyl-N-(trifluoromethylthio)aniline Methanesulfenamide, 1,1,1-trifluoro-N-methyl-N-phenyl- N-methyl-N-phenyl-S-(trifluoromethyl)thiohydroxylamine | [EINECS(EC#)]
808-170-5 | [Molecular Formula]
C8H8F3NS | [MDL Number]
MFCD28384150 | [MOL File]
66476-44-6.mol | [Molecular Weight]
207.22 |
| Chemical Properties | Back Directory | [Boiling point ]
151.2±50.0 °C(Predicted) | [density ]
1.313±0.06 g/cm3(Predicted) | [refractive index ]
1.4920 to 1.4960 | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
clear liquid | [pka]
-0.18±0.50(Predicted) | [color ]
Colorless to Almost colorless | [InChI]
InChI=1S/C8H8F3NS/c1-12(13-8(9,10)11)7-5-3-2-4-6-7/h2-6H,1H3 | [InChIKey]
TYFGNILTFVMYGX-UHFFFAOYSA-N | [SMILES]
C(F)(F)(F)SN(C)C1=CC=CC=C1 |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|