| Identification | Back Directory | [Name]
1-PYRENEBUTANOL | [CAS]
67000-89-9 | [Synonyms]
1-PYRENEBUTANOL 1-pyrenees butanol 1-Pyrenebutanol 99% 4-(1-PYRENYL)-N-BUTANOL 4-(1-Pyrenyl)-1-butanol 4-(pyren-1-yl)butan-1-ol 1-Pyrenebutanol extrapure, 99% | [Molecular Formula]
C20H18O | [MDL Number]
MFCD00192423 | [MOL File]
67000-89-9.mol | [Molecular Weight]
274.36 |
| Chemical Properties | Back Directory | [Melting point ]
80-83 °C (lit.) | [Boiling point ]
488.4±24.0 °C(Predicted) | [density ]
1.217±0.06 g/cm3(Predicted) | [pka]
15.15±0.10(Predicted) | [InChI]
InChI=1S/C20H18O/c21-13-2-1-4-14-7-8-17-10-9-15-5-3-6-16-11-12-18(14)20(17)19(15)16/h3,5-12,21H,1-2,4,13H2 | [InChIKey]
MRENSFROWALQNU-UHFFFAOYSA-N | [SMILES]
C1(CCCCO)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
| Hazard Information | Back Directory | [Uses]
1-Pyrenebutanol is a interfacial agent for bisphenol-A polycarbonate and multi-walled carbon nanotube composites. | [General Description]
1-Pyrenebutanol, an alcohol, is an organic building block. It participates in the polymerization of cyclic esters (lactide, δ-valerolactone and ε-caprolactone). |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Synchem OHG
|
| Tel: |
+49 5662 408730 |
| Website: |
www.synchem.de |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|