| Identification | Back Directory | [Name]
6-chloro-2,3,4,5-tetrahydro-7,8-dihydroxy-1-(4-hydroxyphenyl)-1H-3-benzazepinium bromide | [CAS]
67287-54-1 | [Synonyms]
SKF 82526 HydrobroMide FenoldopaM HydrobroMide (±)-SKF 82526 HydrobroMide FENOLDOPAM MONOHYDROBROMIDE 6-Chloro-2,3,4,5-tetrahydro-1-(4-hydroxyphenyl)-1H-3-benzazepine-7,8-diol HydrobroMide 6-chloro-2,3,4,5-tetrahydro-7,8-dihydroxy-1-(4-hydroxyphenyl)-1H-3-benzazepinium bromide 6-chloro-2,3,4,5-tetrahydro-1-(4-hydroxyphenyl)-1h-3-benzazepine-7,8-diol monohydrobromide | [EINECS(EC#)]
266-634-7 | [Molecular Formula]
C16H16ClNO3.BrH | [MDL Number]
MFCD27977921 | [MOL File]
67287-54-1.mol | [Molecular Weight]
386.67 |
| Chemical Properties | Back Directory | [Melting point ]
>233°C (dec.) | [storage temp. ]
2-8°C | [solubility ]
DMSO: >12mg/mL | [form ]
Solid | [color ]
off-white | [InChI]
1S/C16H16ClNO3.BrH/c17-15-11-5-6-18-8-13(9-1-3-10(19)4-2-9)12(11)7-14(20)16(15)21;/h1-4,7,13,18-21H,5-6,8H2;1H | [InChIKey]
DSGOSRLTVBPLCU-UHFFFAOYSA-N | [SMILES]
ClC1=C(O)C(O)=CC2=C1CCNCC2C3=CC=C(O)C=C3.[H]Br |
| Hazard Information | Back Directory | [Uses]
Dopamine D1-receptor agonist. Antihypertensive. | [Biochem/physiol Actions]
Fenoldopam is a selective dopamine agonist that is being considered for the parenteral treatment of systemic hypertension. In both an oral and parenteral form, fenoldopam causes peripheral vasodilation by stimulating dopamine-1 adrenergic receptors. Intravenous fenoldopam may provide advantages over sodium nitroprusside because it can induce both a diuresis and natriuresis, is not light sensitive, and is not associated with cyanide toxicity. There is no evidence for rebound hypertension after discontinuation of fenoldopam infusion. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Pharma Affiliates
|
| Tel: |
172-5066494 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList694812/0_EN.htm |
|