| Identification | Back Directory | [Name]
10-Ethyl-3,7,8-trimethyl-benzo[g]pteridine-2,4(3H,10H)-dione | [CAS]
67767-38-8 | [Synonyms]
10-Ethyl-3,7,8-trimethyl-benzo[g]pteridine-2,4(3H,10H)-dione | [Molecular Formula]
C15H16N4O2 | [MDL Number]
MFCD30474981 | [MOL File]
67767-38-8.mol | [Molecular Weight]
284.31 |
| Chemical Properties | Back Directory | [Melting point ]
290 °C | [Boiling point ]
450.8±55.0 °C(Predicted) | [density ]
1.34±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [form ]
powder or crystals | [pka]
-2.01±0.20(Predicted) | [Appearance]
White to off-white Solid | [InChIKey]
FMSUGHVGTYMDRD-UHFFFAOYSA-N | [SMILES]
O=C(C1=NC2=CC(C)=C(C)C=C2N(CC)C1=N3)N(C)C3=O |
| Hazard Information | Back Directory | [Uses]
10-Ethyl-3,7,8-trimethyl-benzo[g]pteridine-2,4(3H,10H)-dione is a flavin-based photocatalyst that can be used for photooxidation of alcohols. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Photocatalysis reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|