| Identification | Back Directory | [Name]
(R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol | [CAS]
681481-94-7 | [Synonyms]
(R)-4,4'-Dibromo-1,1'-spirobiindane-7,7'-diol (R)-4,4'-Dibromo-7,7'-dihydroxy-1,1'-spirobiindane (R)-4,4'-dibromo-7,7'-dimethoxy-2,2',3,3'-tetrahydro-1,1'-spirobi[indene] 1,1'-Spirobi[1H-indene]-7,7'-diol, 4,4'-dibromo-2,2',3,3'-tetrahydro-, (1R)- (9CI) | [Molecular Formula]
C17H14Br2O2 | [MOL File]
681481-94-7.mol | [Molecular Weight]
410.1 |
| Chemical Properties | Back Directory | [Melting point ]
161 °C | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C17H14Br2O2/c18-11-1-3-13(20)15-9(11)5-7-17(15)8-6-10-12(19)2-4-14(21)16(10)17/h1-4,20-21H,5-8H2 | [InChIKey]
OZVMVFKUNSNXQC-UHFFFAOYSA-N | [SMILES]
[C@@]12(C3=C(C(Br)=CC=C3O)CC1)C1=C(C(Br)=CC=C1O)CC2 |
| Questions And Answer | Back Directory | [Uses]
(R)-4,4'-dibromo-1,1'-spirodiindan-7,7'-diol is a heterocyclic derivative that can be used as an intermediate in organic synthesis. |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
| Company Name: |
TCI America
|
| Tel: |
800 423 8616 |
| Website: |
www.tcichemicals.com/en/us |
|