| Identification | Back Directory | [Name]
5-CHLORO-8-NITROQUINOLINE | [CAS]
6942-98-9 | [Synonyms]
NSC 51628
5-CHLORO-8-NITROQUINOLINE
Quinoline, 5-chloro-8-nitro- | [Molecular Formula]
C9H5ClN2O2 | [MDL Number]
MFCD00552691 | [MOL File]
6942-98-9.mol | [Molecular Weight]
208.6 |
| Chemical Properties | Back Directory | [Melting point ]
136-136.5℃ | [Boiling point ]
353.6±27.0 °C(Predicted) | [density ]
1.484±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [pka]
0.12±0.29(Predicted) | [Appearance]
Light yellow to yellow Solid | [InChI]
InChI=1S/C9H5ClN2O2/c10-7-3-4-8(12(13)14)9-6(7)2-1-5-11-9/h1-5H | [InChIKey]
DHRPLGHWWKFRKY-UHFFFAOYSA-N | [SMILES]
N1C2C(=C(Cl)C=CC=2[N+]([O-])=O)C=CC=1 |
| Hazard Information | Back Directory | [Uses]
5-Chloro-8-nitroquinoline itself is not typically used as a final product; its core value lies in its role as a pharmaceutical intermediate. Its primary use is in the synthesis of bioactive molecules, particularly antimalarial drugs. | [Reactions]
5-Chloro-8-nitroquinoline is a heterocyclic compound featuring a quinoline backbone substituted with a chlorine atom at position 5 and a nitro group at position 8 . The chlorine substituent enhances its biological activity by modulating electronic properties and binding interactions, while the nitro group contributes to its redox activity and coordination chemistry. |
|
| Company Name: |
SynAsst Chemical.
|
| Telephone: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
|