| Identification | Back Directory | [Name]
(aR,)-rel-a-tert-Butyl-b-(4-chlorophenoxy)-1H-1,2,4-triazole-1-ethanol PESTANAL | [CAS]
70585-35-2 | [Synonyms]
(αR,βS)-rel-α-tert-Butyl-β-(4-chlorophenoxy)-1H-1,2,4-triazole-1-ethanol
(aR,)-rel-a-tert-Butyl-b-(4-chlorophenoxy)-1H-1,2,4-triazole-1-ethanol PESTANAL
1H-1,2,4-Triazole-1-ethanol, β-(4-chlorophenoxy)-α-(1,1-dimethylethyl)-, (αR,βS)-rel- | [Molecular Formula]
C14H18ClN3O2 | [MDL Number]
MFCD31656807 | [MOL File]
70585-35-2.mol | [Molecular Weight]
295.76 |
| Chemical Properties | Back Directory | [Boiling point ]
465.4±55.0 °C(Predicted) | [density ]
1.24±0.1 g/cm3(Predicted) | [Fp ]
100 °C | [pka]
13.29±0.20(Predicted) | [Major Application]
agriculture
environmental | [InChI]
1S/C14H18ClN3O2/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h4-9,12-13,19H,1-3H3/t12-,13-/m0/s1 | [InChIKey]
BAZVSMNPJJMILC-STQMWFEESA-N | [SMILES]
CC(C)(C)[C@@H](O)[C@H](Oc1ccc(Cl)cc1)n2cncn2 |
| Hazard Information | Back Directory | [Uses]
Triadimenol A is a fungicide and is formed through the enantioselective degradation, abiotic racemization, and chiral transformation of triadimefon in soils. |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|