| Identification | Back Directory | [Name]
1,3-DIDECYL-2-METHYLIMIDAZOLIUM CHLORIDE | [CAS]
70862-65-6 | [Synonyms]
1,3-DIDECYL-2-METHYLIMIDAZOLIUM CHLORIDE 1,3-didecyl-2-methyl-1H-imidazolium chloride 1,3-Didecyl-2-MethyliMidazoliuM chloride 96% 1,3-Didecyl-2-methylimidazolium chloride, >98% 1,3-DIDECYL-2-METHYL-1H-IMIDAZOL-3-IUM CHLORIDE | [EINECS(EC#)]
274-948-0 | [Molecular Formula]
C24H47ClN2 | [MDL Number]
MFCD00216605 | [MOL File]
70862-65-6.mol | [Molecular Weight]
399.1 |
| Chemical Properties | Back Directory | [Melting point ]
82 °C | [form ]
solid | [color ]
Yellow to brown | [InChI]
1S/C24H47N2.ClH/c1-4-6-8-10-12-14-16-18-20-25-22-23-26(24(25)3)21-19-17-15-13-11-9-7-5-2;/h22-23H,4-21H2,1-3H3;1H/q+1;/p-1 | [InChIKey]
GJYWPRKIEORZLX-UHFFFAOYSA-M | [SMILES]
[Cl-].CCCCCCCCCCn1cc[n+](CCCCCCCCCC)c1C |
| Hazard Information | Back Directory | [Uses]
1,3-Didecyl-2-methylimidazolium chloride can be used:
- To prepare a new ionic liquid named 1,3-didecyl-2-methylimidazolium dicyanamide, which is applicable in the water/butan-1-ol separation process.
- To coat a graphene oxide and magnetite based nanocomposite applicable in the separation of hemin from serum samples.
- As a pore directing agent in the synthesis of mesoporous hectorites for drug delivery applications.
|
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|