| Identification | Back Directory | [Name]
pregn-5-ene-3,20-dione bis(ethylene ketal) | [CAS]
7093-55-2 | [Synonyms]
pregn-5-ene-3,20-dione bis(ethylene ketal)
Pregn-5-ene-3,20-dione, cyclic 3,20-bis(1,2-ethanediyl acetal)
(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] | [EINECS(EC#)]
407-450-0 | [Molecular Formula]
C25H38O4 | [MOL File]
7093-55-2.mol | [Molecular Weight]
402.57 |
| Chemical Properties | Back Directory | [solubility ]
Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) | [form ]
Solid | [color ]
White to Off-White | [InChIKey]
HXAKLOQIIUGBBR-JMMGALRRNA-N | [SMILES]
C12(OCCO1)CC1[C@](C)(CC2)[C@]2([H])[C@]([H])([C@@]3([H])[C@@](CC2)(C)[C@@H](C2(OCCO2)C)CC3)CC=1 |&1:7,11,13,15,17,21,r| |
| Hazard Information | Back Directory | [Uses]
Pregn-5-ene-3,20-dione Bis(cyclic ethylene acetal) is a useful synthetic intermediate in the synthesis of 3,20-Bis(ethylenedioxy)pregna-5,7-diene (B433805); the 3,20-bis(ethylenedioxy) analog of Ergosterol (E599240) which is the most important provitamin D and is usually obtained from yeast that synthesize it from simple sugars such as glucose. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
mahaloong
|
| Tel: |
028-81192082 18180560816 |
| Website: |
https://www.mahaloong.com |
| Company Name: |
CDYXYL
|
| Tel: |
13688280140 |
| Website: |
|
|