| Identification | Back Directory | [Name]
5-NITRO-M-XYLENE-ALPHA,ALPHA'-DIOL | [CAS]
71176-55-1 | [Synonyms]
5-nitro-m-xylene-α,α'-diol 5-Nitro-M-xylene-α,α′-diol 5-Nitro-1,3-benzenedimethanol 1,3-BenzenediMethanol,5-nitro- (5-Nitro-1,3-phenylene)diMethanol 5-NITRO-M-XYLENE-ALPHA,ALPHA'-DIOL 5-NITRO-1,3-DIHYDROXYMETHYLBENZENE 3-(Hydroxymethyl)-5-nitrobenzyl alcohol 3-(Hydroxymethyl)-5-nitro-phenylmethanol | [EINECS(EC#)]
275-255-6 | [Molecular Formula]
C8H9NO4 | [MDL Number]
MFCD00007274 | [MOL File]
71176-55-1.mol | [Molecular Weight]
183.16 |
| Chemical Properties | Back Directory | [Melting point ]
94-96 °C (lit.) | [Boiling point ]
421.9±35.0 °C(Predicted) | [density ]
1.420 | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
solid | [pka]
13.45±0.10(Predicted) | [InChI]
InChI=1S/C8H9NO4/c10-4-6-1-7(5-11)3-8(2-6)9(12)13/h1-3,10-11H,4-5H2 | [InChIKey]
FTLFITNFXXERLN-UHFFFAOYSA-N | [SMILES]
C1(CO)=CC([N+]([O-])=O)=CC(CO)=C1 |
| Hazard Information | Back Directory | [Uses]
5-Nitro-m-xylene-α,α′-diol was used to fabricate chemical sensor for detection of explosive 2,4,6-trinitrotoluene by planar integrated optical waveguide attenuated total reflection spectrometry. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Wuxi AppTec
|
| Tel: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
|