| Identification | Back Directory | [Name]
3-(2',4'-DIFLUOROPHENYL)-3-OXOPROPANENITRILE | [CAS]
71682-95-6 | [Synonyms]
BUTTPARK 81\09-14 2,4-DIFLUOROBENZOYLACETONITRILE 2,4-Difluorobenzoylacetonitrile97% 2,4-Difluorobenzoylacetonitrile 97% 2,4-Difluoro-b-oxo-benzenepropanenitrile Benzenepropanenitrile,2,4-difluoro-b-oxo- Benzenepropanenitrile, 2,4-difluoro-β-oxo- 3-(2',4'-DIFLUOROPHENYL)-3-OXOPROPANENITRILE 3-(2,4-Difluorophenyl)-3-oxopropanenitrile, 3-(2,4-Difluorophenyl)-3-oxopropionitrile | [Molecular Formula]
C9H5F2NO | [MDL Number]
MFCD02260804 | [MOL File]
71682-95-6.mol | [Molecular Weight]
181.14 |
| Chemical Properties | Back Directory | [Melting point ]
110-112° | [storage temp. ]
2-8°C | [form ]
tiny crystalline solid | [color ]
Off white/faint lemon | [InChI]
InChI=1S/C9H5F2NO/c10-6-1-2-7(8(11)5-6)9(13)3-4-12/h1-2,5H,3H2 | [InChIKey]
IHOQJCDNMJJLME-UHFFFAOYSA-N | [SMILES]
C1(C=CC(F)=CC=1F)C(=O)CC#N |
| Hazard Information | Back Directory | [Uses]
3-(2,4-Difluorophenyl)-3-oxopropanenitrile is used as a reagent to synthesize benzoylnacetonitriles, compounds that have potential antiarthritic effects. |
|
| Company Name: |
HBCChem, Inc.
|
| Tel: |
+1-510-219-6317 |
| Website: |
www.warehouse-sample-usa.com |
|