| Identification | Back Directory | [Name]
thielavin B | [CAS]
71950-67-9 | [Synonyms]
thielavin B 4-[(2,4-Dihydroxy-3,6-dimethylbenzoyl)oxy]-2-methoxy-3,5,6-trimethylbenzoic acid 4-carboxy-3-methoxy-2,5,6-trimethylphenyl ester | [MDL Number]
MFCD11111623 | [MOL File]
71950-67-9.mol |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [solubility ]
DMF: soluble; DMSO: soluble; Ethanol: soluble | [form ]
White to off-white powder. | [Major Application]
metabolomics vitamins, nutraceuticals, and natural products | [InChIKey]
UULGWGARYDGVBM-UHFFFAOYSA-N | [SMILES]
O=C(C1=C(OC)C(C)=C(OC(C2=C(O)C(C)=C(O)C=C2C)=O)C(C)=C1C)OC3=C(C)C(C)=C(C(O)=O)C(OC)=C3C |
| Hazard Information | Back Directory | [Description]
Thielavin B is a fungal metabolite that contains O-substituted salicylic acid. It inhibits cyclooxygenase, blocking both the conversion of arachidonic acid to Prostaglandin H2 (PGH2) and the conversion of PGH2 to PGE2 (, IC50s = 40 and 9 μM, respectively). Thielavin B also inhibits the reverse transcriptase of avian myeloblastosis virus, bacterial transglycosylases, and telomerase activity. | [Uses]
Thielavin B is a fungal metabolite closely related to thielavin A but reported to have a slightly different biochemical profile. Thielavins inhibit glucose-6-phosphatase. Thielavin B is a potent inhibitor of phospholipase C, and inhibits peptidoglycan formation and prostaglandin biosynthesis. | [Uses]
Thielavin B is a fungal metabolite of?Thielavia terricola that contains O-substituted salicylic acid. It is an inhibitor of viral reverse transcriptase and telomerase. | [General Description]
Natural product derived from fungal source. | [References]
[1] N MANI. Screening systems for detecting inhibitors of cell wall transglycosylation in Enterococcus. Cell wall transglycosylation inhibitors in Enterococcus.[J]. Journal of Antibiotics, 1998, 51 5: 471-479. DOI: 10.7164/antibiotics.51.471 [2] KEN-ICHI TOGASHI. Inhibition of Telomerase Activity by Fungus Metabolites, CRM646-A and Thielavin B[J]. Bioscience, Biotechnology, and Biochemistry, 2001, 65 1: 651-653. DOI: 10.1271/bbb.65.651 |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|