| Identification | Back Directory | [Name]
Pseudomonic acid C | [CAS]
71980-98-8 | [Synonyms]
Pseudomonic acid C Mupirocin Caclium Impurity B Mupirocin calcium impurity B Mupirocin Calcium EP Impurity B Mupirocin Calcium Impurity 2(Mupirocin Calcium EP Impurity B) 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid L-talo-Non-2-enonic acid, 5,9-anhydro-2,3,4,8-tetradeoxy-8-[(2E,4R,5S)-5-hydroxy-4-methyl-2-hexen-1-yl]-3-methyl-, 8-carboxyoctyl ester, (2E)- 9-(((E)-4-((2S,3R,4R,5S)-3,4-dihydroxy-5-((4R,5S,E)-5-hydroxy-4-methylhex-2-en-1-yl)tetrahydro-2H-pyran-2-yl)-3-methylbut-2-enoyl)oxy)nonanoic acid 9-[[(2E)-4-[[(2S,3R,4R,5S)-3α,4α-Dihydroxy-5β-[(2E,4S,5S)-5-hydroxy-4-methyl-2-hexenyl]tetrahydro-2H-pyran]-2β-yl]-3-methyl-2-butenoyl]oxy]nonanoic acid Mupirocin EP Impurity B/Pseudomonic Acid C/9-[[(2E)-4-[(2S,3R,4R,5S)-3,4-Dihydroxy-5-[(2E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]tetrahydro-2H-pyran-2-yl]-3-methylbut-2-enoyl]oxy]nonanoic acid | [Molecular Formula]
C26H44O8 | [MOL File]
71980-98-8.mol | [Molecular Weight]
484.63 |
| Chemical Properties | Back Directory | [alpha ]
D25 +7.64° (c = 0.78 in chloroform) | [Boiling point ]
656.2±55.0 °C(Predicted) | [density ]
1.125±0.06 g/cm3(Predicted) | [storage temp. ]
-20°C Freezer, Under Inert Atmosphere | [solubility ]
Chloroform (Slightly), methanol (Slightly) | [form ]
Oil | [pka]
4.78±0.10(Predicted) | [color ]
Colourless | [InChIKey]
KKMHFUKZHJOMJL-QEPDBURXNA-N | [SMILES]
C([C@@H]1OC[C@H](C/C=C/[C@@H](C)[C@@H](O)C)[C@@H](O)[C@H]1O)/C(/C)=C/C(=O)OCCCCCCCCC(=O)O |&1:1,4,8,10,13,15,r| |
| Hazard Information | Back Directory | [Uses]
Pseudomonic Acid C, is the analogue of Pseudomonic Acid D (P839520) which is an antibiotic isolated from Pseudomonas fluorescens. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
| Company Name: |
TOSUN PHARM
|
| Tel: |
61855200 13326451905 |
| Website: |
www.toref.cn/ |
|