| Identification | Back Directory | [Name]
H-PHE-GLY-OH | [CAS]
721-90-4 | [Synonyms]
FG PHE-GLY L-Phe-Gly Phe-Gly-OH H-PHE-GLY-OH L-Phe-Gly-OH Phe-Gly hydrate Phe-glycrystalline L-PHENYLALANYLGLYCINE Phe-Gly-OH≥95% (HPLC) Glycine, L-phenylalanyl- Phe-Gly hydrate >=98.0% (dried material) (S)-2-(2-Amino-3-phenylpropanamido)acetic acid 2-[(2-amino-3-phenylpropanoyl)amino]acetic acid 2-[(2-amino-3-phenyl-propanoyl)amino]acetic acid 2-[(2-azanyl-3-phenyl-propanoyl)amino]ethanoic acid 2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetic acid | [EINECS(EC#)]
222-027-9 | [Molecular Formula]
C11H14N2O3 | [MDL Number]
MFCD00021728 | [MOL File]
721-90-4.mol | [Molecular Weight]
222.24 |
| Chemical Properties | Back Directory | [Melting point ]
~260 °C (dec.)
| [Boiling point ]
512.5±50.0 °C(Predicted) | [density ]
1.259±0.06 g/cm3(Predicted) | [storage temp. ]
-15°C | [solubility ]
Methanol (Slightly), Water (Sparingly, Sonicated) | [form ]
Solid | [pka]
3.13±0.10(Predicted) | [color ]
White to Off-White | [Optical Rotation]
[α]20/D +103±3°, c = 1% in H2O | [BRN ]
2218143 | [Stability:]
Hygroscopic | [Major Application]
peptide synthesis | [InChI]
1S/C11H14N2O3.H2O/c12-9(11(16)13-7-10(14)15)6-8-4-2-1-3-5-8;/h1-5,9H,6-7,12H2,(H,13,16)(H,14,15);1H2/t9-;/m0./s1 | [InChIKey]
QNLAQUFDXQTNOW-FVGYRXGTSA-N | [SMILES]
O.N[C@@H](Cc1ccccc1)C(=O)NCC(O)=O |
| Hazard Information | Back Directory | [Chemical Properties]
White product | [Uses]
Phenylalanylglycine can be used to mask unpleasant taste impressions. | [Definition]
ChEBI: A dipeptide formed from L-phenylalanine and glycine residues. | [Enzyme inhibitor]
This dipeptide (FW = 206.24 g/mol; Sequence: FG) inhibits cytochrome c
aggregation, g-glutamyl transpeptidase, neprilysin, IC50 = 30.2 μM
, and peptidyl-dipeptidase A. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Nextpeptide Inc
|
| Telephone: |
+86-0571-81612335 +8613336028439 |
| Website: |
http://www.nextpeptide.com/ |
| Company Name: |
Binhai gill polypeptide co. LTD
|
| Telephone: |
021-61263389 13524856427 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList326362/0_EN.htm |
|