| Identification | Back Directory | [Name]
5-Chloro AcesulfaMe | [CAS]
72827-08-8 | [Synonyms]
5-Chloro AcesulfaMe
Acesulfame Impurity 2
Acesulfame EP Impurity B
Acesulfame Potassium EP Impurity B
Acesulfame Impurity 1(Acesulfame EP Impurity B)
5-Chloro-6-methyl-1,2,3-oxathiazin-4(3H)-one 2,2-dioxide
b.?5-chloro-6-methyl-1,2,3-oxathiazin-4(3h)-one2,2-dioxide.
1,2,3-Oxathiazin-4(3H)-one, 5-chloro-6-methyl-, 2,2-dioxide
5-Chlor-6-methyl-3,4-dihydro-1,2,3-oxathiazin-4-on-2,2-dioxid
Acesulfame potassium impurity B (A0070020)Q: What is
Acesulfame potassium impurity B (A0070020) Q: What is the CAS Number of
Acesulfame potassium impurity B (A0070020) | [Molecular Formula]
C4H4ClNO4S | [MDL Number]
MFCD02258240 | [MOL File]
72827-08-8.mol | [Molecular Weight]
197.6 |
| Chemical Properties | Back Directory | [Melting point ]
>162°C (dec.) | [density ]
1.75±0.1 g/cm3(Predicted) | [storage temp. ]
-20°C Freezer | [solubility ]
Acetonitrile (Slightly), Methanol (Slightly) | [pka]
-1.95±0.60(Predicted) | [color ]
White to Off-White | [Major Application]
pharmaceutical (small molecule) | [InChI]
InChI=1S/C4H4ClNO4S/c1-2-3(5)4(7)6-11(8,9)10-2/h1H3,(H,6,7) | [InChIKey]
YVZOKLTZSNJEQX-UHFFFAOYSA-N | [SMILES]
O1C(C)=C(Cl)C(=O)NS1(=O)=O |
| Hazard Information | Back Directory | [Uses]
5-Chloro Acesulfame, is an impurity of Acesulfame (A132500), the artificial sweetener, and a new sweet-tasting oxathiazinone dioxides. Acesulfame Potassium Impurity B |
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
61855200 13326451905 |
| Website: |
www.toref.cn/ |
|