| Identification | Back Directory | [Name]
Bis(4-fluorophenyl)iodonium trifluoromethanesulfonate | [CAS]
732306-64-8 | [Synonyms]
(p-F-Ph)2IOTf BIS(4-FLUOROPHENYL)IODONIUM TRIFLATE Bis(4-fluorophenyl)iodonium triflate >=98% (HPLC) Bis(4-fluorophenyl)iodonium trifluoromethanesulfonate Iodonium, bis(4-fluorophenyl)-, 1,1,1-trifluoromethanesulfonate (1:1) | [Molecular Formula]
C13H8F5IO3S | [MDL Number]
MFCD21608479 | [MOL File]
732306-64-8.mol | [Molecular Weight]
466.162 |
| Chemical Properties | Back Directory | [Melting point ]
167.0 to 171.0 °C | [storage temp. ]
2-8°C, sealed storage, away from moisture | [solubility ]
soluble in Methanol | [form ]
powder to crystal | [color ]
White to Almost white | [BRN ]
10620586 | [InChI]
InChI=1S/C12H8F2I.CHF3O3S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;2-1(3,4)8(5,6)7/h1-8H;(H,5,6,7)/q+1;/p-1 | [InChIKey]
HTFNIUDXMGKTQK-UHFFFAOYSA-M | [SMILES]
[I+](C1C([H])=C([H])C(=C([H])C=1[H])F)C1C([H])=C([H])C(=C([H])C=1[H])F.S(C(F)(F)F)(=O)(=O)[O-] |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|