| Identification | Back Directory | [Name]
tert-Butyl N-[5-bromo-2-chlorophenyl]carbamate | [CAS]
740806-51-3 | [Synonyms]
tert-butyl (5-bromo-2-chlorophenyl)carbamate tert-Butyl N-[5-bromo-2-chlorophenyl]carbamate Carbamic acid, N-(5-bromo-2-chlorophenyl)-, 1,1-dimethylethyl ester | [Molecular Formula]
C11H13BrClNO2 | [MOL File]
740806-51-3.mol | [Molecular Weight]
306.58 |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|