| Identification | Back Directory | [Name]
4-AZIDOPHENYL ISOTHIOCYANATE | [CAS]
74261-65-7 | [Synonyms]
4-AZIDOPHENYL ISOTHIOCYANATE 1-azido-4-isothiocyanatobenzene | [Molecular Formula]
C7H4N4S | [MDL Number]
MFCD00042980 | [MOL File]
74261-65-7.mol | [Molecular Weight]
176.2 |
| Chemical Properties | Back Directory | [Melting point ]
65-68 °C (lit.) | [storage temp. ]
2-8°C | [BRN ]
6391971 | [InChI]
1S/C7H4N4S/c8-11-10-7-3-1-6(2-4-7)9-5-12/h1-4H | [InChIKey]
XMPGXADJZXSISQ-UHFFFAOYSA-N | [SMILES]
[N-]=[N+]=Nc1ccc(cc1)N=C=S |
| Hazard Information | Back Directory | [Uses]
4-Azidophenyl isothiocyanate may be used in the preparation of:
- peptide conjugated surfaces on silicon surfaces through click chemistry
- kainic acid analog, (2S.3S.4S)-4-[l-(4′-azido-phenyl)thioureylenernethy lethenyl]-2-carboxy-3-pyrro-lidineacetic acid
- photosensitive nanoparticles bearing azidophenyl units at their surface
| [General Description]
4-Azidophenyl isothiocyanate is an aromatic azide. | [reaction suitability]
reaction type: click chemistry |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
ChemShuttle, Inc.
|
| Telephone: |
83588313 18800520310 |
| Website: |
www.chemshuttle.com/ |
|