| Identification | Back Directory | [Name]
2-Dibenzothiophenamine | [CAS]
7428-91-3 | [Synonyms]
NSC 170576 2-Dibenzothiophenamine 2-Aminodibenzothiophene Dibenzothiophen-2-amine Dibenzo[b,d]thiophen-2-amine | [Molecular Formula]
C12H9NS | [MDL Number]
MFCD00995227 | [MOL File]
7428-91-3.mol | [Molecular Weight]
199.27 |
| Chemical Properties | Back Directory | [Melting point ]
133-135 °C(Solv: methanol (67-56-1)) | [Boiling point ]
413.2±18.0 °C(Predicted) | [density ]
1.333±0.06 g/cm3(Predicted) | [form ]
powder to crystal | [pka]
4.12±0.30(Predicted) | [color ]
Light yellow to Brown to Dark green | [InChI]
InChI=1S/C12H9NS/c13-8-5-6-12-10(7-8)9-3-1-2-4-11(9)14-12/h1-7H,13H2 | [InChIKey]
ICMMJWDNKMITSS-UHFFFAOYSA-N | [SMILES]
C12=CC=C(N)C=C1C1=CC=CC=C1S2 | [CAS DataBase Reference]
7428-91-3 |
|
| Company Name: |
Baynoe Chem Co.,LTD
|
| Telephone: |
+86-021-34783353 15000719740 |
| Website: |
http://www.baynoe.com |
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
| Company Name: |
BAYNOE CHEM CO.,LTD
|
| Telephone: |
+86-21-34783353 +8615000719740 |
| Website: |
www.baynoe.com |
| Company Name: |
Richest Group Ltd
|
| Telephone: |
18017061086 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList664261/0_EN.htm |
|