| Identification | Back Directory | [Name]
allyl chlorooxoacetate | [CAS]
74503-07-4 | [Synonyms]
Allyl oxalyl chloride
allyl chlorooxoacetate
Allyl oxalyl chloride 97%
Allyl 2-chloro-2-oxoacetate
2-Propen-1-yloxy chloroacetate
Oxochloroacetic acid allyl ester
prop-2-enyl 2-chloro-2-oxoacetate
Oxalic acid monoallyl ester chloride
2-Chloro-2-oxoacetic acid allyl ester
Chlorooxoacetic acid 2-propenyl ester
2-Chloro-2-oxoacetic acid 2-propenyl ester
Acetic acid,2-chloro-2-oxo-, 2-propen-1-yl ester | [EINECS(EC#)]
277-900-7 | [Molecular Formula]
C5H5ClO3 | [MDL Number]
MFCD08274650 | [MOL File]
74503-07-4.mol | [Molecular Weight]
148.54 |
| Chemical Properties | Back Directory | [Boiling point ]
50-51 °C(Press: 12 Torr) | [density ]
1.213g/mLat 25℃ | [refractive index ]
n20/D 1.443 | [Fp ]
56°C | [form ]
liquid | [InChI]
InChI=1S/C5H5ClO3/c1-2-3-9-5(8)4(6)7/h2H,1,3H2 | [InChIKey]
HNOLIWBAJVIBOU-UHFFFAOYSA-N | [SMILES]
C(OCC=C)(=O)C(Cl)=O |
| Hazard Information | Back Directory | [Description]
Allyl chlorooxoacetate is a pharmaceutical intermediate compound for the preparation of Sulopenem, which is an orally active parenteral penem antibiotic used for the treatment of urinary tract infections and intra-abdominal infections caused by multi-drug resistance. | [Uses]
Allyl Oxalyl Chloride can be prepared to be used as pesticides and fungicides. |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
DebyeTec.com Inc.
|
| Telephone: |
18086626237 18086626237 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList16955/0.htm |
|