| Identification | Back Directory | [Name]
tributyl prop-1-ene-1,2,3-tricarboxylate | [CAS]
7568-58-3 | [Synonyms]
Tributyl aconitate Tributyl (E)-Propene-1,2,3-tricarbo Tributyl Acetylcitrate EP Impurity B tributyl 1-propen-1,2,3-tricarboxylate tributyl prop-1-ene-1,2,3-tricarboxylate 1-Propene-1,2,3-tricarboxylic acid tributyl ester 1-Propene-1,2,3-tricarboxylic acid, 1,2,3-tributyl ester Tributyl prop-1-ene-1,2,3-tricarboxylate (mixture of E and Z) | [EINECS(EC#)]
231-468-6 | [Molecular Formula]
C18H30O6 | [MOL File]
7568-58-3.mol | [Molecular Weight]
342.43 |
| Chemical Properties | Back Directory | [Boiling point ]
121 °C(Press: 2 Torr) | [density ]
1.039±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C18H30O6/c1-4-7-10-22-16(19)13-15(18(21)24-12-9-6-3)14-17(20)23-11-8-5-2/h13H,4-12,14H2,1-3H3 | [InChIKey]
BANLNYYTSYHBAP-UHFFFAOYSA-N | [SMILES]
C(C(OCCCC)=O)=C(C(OCCCC)=O)CC(OCCCC)=O |
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|