| Identification | Back Directory | [Name]
3-(DANSYLAMINO)PHENYLBORONIC ACID | [CAS]
75806-94-9 | [Synonyms]
FB-1【MOAB】 RARECHEM AH PB 0012 DANSYLAMINOPHENYLBORONIC ACID M-DANSYLAMINOPHENYLBORONIC ACID DANSYL AMIDOPHENYL BORONIC ACID 3-(DANSYLAMINO)PHENYLBORONIC ACID 3-(Dansylamido)benzeneboronic acid N-dansyl-3-aminobenzeneboronic acid N-5-DIMETHYLAMINO-1-NAPHTHALENE SULFONY& N-5-dimethylamino-1-naphthalene*sulfonyl-3-aminob 3-DANSYLAMINOPHENYLBORONIC ACID, FOR FLU ORESCENCE n-5-dimethylamino-1-naphthalenesulfonyl-3-aminobenzene 3-[5-(Dimethylamino)-1-naphtylsulfonylamino]phenylboronic acid 3-[[5-(Dimethylamino)-1-naphtyl]sulfonylamino]phenylboronic acid 3-(5-DIMETHYLAMINONAPHTHALENE-1-SULFONY-LAMINO)BENZENEBORONIC ACID N-(5-DIMETHYLAMINO-1-NAPHTHALENESULFONYL)-3-AMINOBENZENEBORONIC ACID [3-[[[5-(dimethylamino)-1-naphthyl]sulphonyl]amino]phenyl]metaboric acid [3-[[[5-(Dimethylamino)-1-naphthalenyl]sulfonyl]amino]phenyl]boronic acid [3-[[[5-(Dimethylamino)naphthalene-1-yl]sulfonyl]amino]phenyl]boronic acid 3-(DansylaMino)phenylboronic acid [3-(5-DiMethylaMinonaphthalene-1-sulfonylaMino)benzeneboronic acid] 3-(Dansylamido)benzeneboronic acid, 3-(5-Dimethylaminonaphthalene-1-sulfonylamino)benzeneboronic acid | [EINECS(EC#)]
278-319-1 | [Molecular Formula]
C18H19BN2O4S | [MDL Number]
MFCD00042703 | [MOL File]
75806-94-9.mol | [Molecular Weight]
370.23 |
| Chemical Properties | Back Directory | [Appearance]
light yellow crystalline solid | [Boiling point ]
599.3±60.0 °C(Predicted) | [density ]
1.39±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C
| [form ]
Solid | [pka]
7.81±0.10(Predicted) | [color ]
Light yellow to yellow | [Stability:]
Stable. Incompatible with strong oxidizing agents. | [BRN ]
8012268 | [InChI]
1S/C18H19BN2O4S/c1-21(2)17-10-4-9-16-15(17)8-5-11-18(16)26(24,25)20-14-7-3-6-13(12-14)19(22)23/h3-12,20,22-23H,1-2H3 | [InChIKey]
TYXMKSYBCDTGDU-UHFFFAOYSA-N | [SMILES]
CN(C)c1cccc2c(cccc12)S(=O)(=O)Nc3cccc(c3)B(O)O |
| Hazard Information | Back Directory | [Chemical Properties]
light yellow crystalline solid | [Uses]
Carbohydrate ligand in cell studies1; potent boronic acid serine protease inhibitor.2 | [Description]
3-(Dansylamino)phenylboronic acid is an environment-sensitive fluorescent probe that can be used for in-situ imaging and quantification of sialic acid on cell membrane surfaces. | [Excitation / Emission Maximum]
338 nm/524 nm |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Abcam Limited
|
| Tel: |
021-2070050 400921018 |
| Website: |
www.abcam.cn |
|